C11H16N2O4 — CID 79473739
2-(2-aminoethoxy)-N-(3-hydroxy-4-methoxyphenyl)acetamide (PubChem CID 79473739) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-(3-hydroxy-4-methoxyphenyl)acetamide.
| Compound Name | 2-(2-aminoethoxy)-N-(3-hydroxy-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 79473739 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-(2-aminoethoxy)-N-(3-hydroxy-4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COCCN)cc1O |
| InChI | InChI=1S/C11H16N2O4/c1-16-10-3-2-8(6-9(10)14)13-11(15)7-17-5-4-12/h2-3,6,14H,4-5,7,12H2,1H3,(H,13,15) |
| InChIKey | FYYRWNNHYHFVRS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|