C11H14Cl2N2O3S — CID 43700521
5-chloro-N-(2-chloro-5-sulfamoylphenyl)pentanamide (PubChem CID 43700521) has the molecular formula C11H14Cl2N2O3S and a molecular weight of 325.22 g/mol. Its IUPAC name is 5-chloro-N-(2-chloro-5-sulfamoylphenyl)pentanamide.
| Compound Name | 5-chloro-N-(2-chloro-5-sulfamoylphenyl)pentanamide |
|---|---|
| PubChem CID | 43700521 |
| Molecular Formula | C11H14Cl2N2O3S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 5-chloro-N-(2-chloro-5-sulfamoylphenyl)pentanamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(NC(=O)CCCCCl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O3S/c12-6-2-1-3-11(16)15-10-7-8(19(14,17)18)4-5-9(10)13/h4-5,7H,1-3,6H2,(H,15,16)(H2,14,17,18) |
| InChIKey | PPJVTMJZUPKJGH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|