C15H11BrClNO3 — CID 80973088
2-bromo-N-(6-chloro-1,3-benzodioxol-5-yl)-5-methylbenzamide (PubChem CID 80973088) has the molecular formula C15H11BrClNO3 and a molecular weight of 368.61 g/mol. Its IUPAC name is 2-bromo-N-(6-chloro-1,3-benzodioxol-5-yl)-5-methylbenzamide.
| Compound Name | 2-bromo-N-(6-chloro-1,3-benzodioxol-5-yl)-5-methylbenzamide |
|---|---|
| PubChem CID | 80973088 |
| Molecular Formula | C15H11BrClNO3 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 2-bromo-N-(6-chloro-1,3-benzodioxol-5-yl)-5-methylbenzamide |
| SMILES | Cc1ccc(Br)c(C(=O)Nc2cc3c(cc2Cl)OCO3)c1 |
| InChI | InChI=1S/C15H11BrClNO3/c1-8-2-3-10(16)9(4-8)15(19)18-12-6-14-13(5-11(12)17)20-7-21-14/h2-6H,7H2,1H3,(H,18,19) |
| InChIKey | FBASHPUCVLMYOY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |