C16H16N2O3 — CID 43548296
N-(6-amino-1,3-benzodioxol-5-yl)-3,4-dimethylbenzamide (PubChem CID 43548296) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-3,4-dimethylbenzamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 43548296 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc3c(cc2N)OCO3)cc1C |
| InChI | InChI=1S/C16H16N2O3/c1-9-3-4-11(5-10(9)2)16(19)18-13-7-15-14(6-12(13)17)20-8-21-15/h3-7H,8,17H2,1-2H3,(H,18,19) |
| InChIKey | DIPCYJHIQUVJKK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|