C18H21N3O5S — CID 119618127
N-(6-amino-1,3-benzodioxol-5-yl)-4-(tert-butylsulfamoyl)benzamide (PubChem CID 119618127) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-4-(tert-butylsulfamoyl)benzamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-(tert-butylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 119618127 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-(tert-butylsulfamoyl)benzamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)Nc2cc3c(cc2N)OCO3)cc1 |
| InChI | InChI=1S/C18H21N3O5S/c1-18(2,3)21-27(23,24)12-6-4-11(5-7-12)17(22)20-14-9-16-15(8-13(14)19)25-10-26-16/h4-9,21H,10,19H2,1-3H3,(H,20,22) |
| InChIKey | DVFXVELKDCMJPR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|