C19H21BrN2O5S — CID 29472703
N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-4-(tert-butylsulfamoyl)benzamide (PubChem CID 29472703) has the molecular formula C19H21BrN2O5S and a molecular weight of 469.36 g/mol. Its IUPAC name is N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-4-(tert-butylsulfamoyl)benzamide.
| Compound Name | N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-4-(tert-butylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 29472703 |
| Molecular Formula | C19H21BrN2O5S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-4-(tert-butylsulfamoyl)benzamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)Nc2cc3c(cc2Br)OCCO3)cc1 |
| InChI | InChI=1S/C19H21BrN2O5S/c1-19(2,3)22-28(24,25)13-6-4-12(5-7-13)18(23)21-15-11-17-16(10-14(15)20)26-8-9-27-17/h4-7,10-11,22H,8-9H2,1-3H3,(H,21,23) |
| InChIKey | XGXVGAWCZSIWLJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |