C20H25N3O6S — CID 47085140
2-[[4-(tert-butylsulfamoyl)benzoyl]amino]-4,5-dimethoxybenzamide (PubChem CID 47085140) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is 2-[[4-(tert-butylsulfamoyl)benzoyl]amino]-4,5-dimethoxybenzamide.
| Compound Name | 2-[[4-(tert-butylsulfamoyl)benzoyl]amino]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 47085140 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-[[4-(tert-butylsulfamoyl)benzoyl]amino]-4,5-dimethoxybenzamide |
| SMILES | COc1cc(NC(=O)c2ccc(S(=O)(=O)NC(C)(C)C)cc2)c(C(N)=O)cc1OC |
| InChI | InChI=1S/C20H25N3O6S/c1-20(2,3)23-30(26,27)13-8-6-12(7-9-13)19(25)22-15-11-17(29-5)16(28-4)10-14(15)18(21)24/h6-11,23H,1-5H3,(H2,21,24)(H,22,25) |
| InChIKey | QMWRAOVVIXVAGO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |