C21H19N3O5S — CID 55963635
4-methoxy-3-[[4-(phenylsulfamoyl)benzoyl]amino]benzamide (PubChem CID 55963635) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is 4-methoxy-3-[[4-(phenylsulfamoyl)benzoyl]amino]benzamide.
| Compound Name | 4-methoxy-3-[[4-(phenylsulfamoyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 55963635 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 4-methoxy-3-[[4-(phenylsulfamoyl)benzoyl]amino]benzamide |
| SMILES | COc1ccc(C(N)=O)cc1NC(=O)c1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H19N3O5S/c1-29-19-12-9-15(20(22)25)13-18(19)23-21(26)14-7-10-17(11-8-14)30(27,28)24-16-5-3-2-4-6-16/h2-13,24H,1H3,(H2,22,25)(H,23,26) |
| InChIKey | FRPAVRNFPMYKNB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |