C20H18N2O4S — CID 27167578
N-(3-methoxyphenyl)-4-(phenylsulfamoyl)benzamide (PubChem CID 27167578) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-4-(phenylsulfamoyl)benzamide.
| Compound Name | N-(3-methoxyphenyl)-4-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 27167578 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-(3-methoxyphenyl)-4-(phenylsulfamoyl)benzamide |
| SMILES | COc1cccc(NC(=O)c2ccc(S(=O)(=O)Nc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C20H18N2O4S/c1-26-18-9-5-8-17(14-18)21-20(23)15-10-12-19(13-11-15)27(24,25)22-16-6-3-2-4-7-16/h2-14,22H,1H3,(H,21,23) |
| InChIKey | JZPDGYHBIRNSQQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |