C21H20N2O5S — CID 7553556
N-(3-methoxyphenyl)-4-[(4-methoxyphenyl)sulfonylamino]benzamide (PubChem CID 7553556) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-4-[(4-methoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-(3-methoxyphenyl)-4-[(4-methoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 7553556 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-(3-methoxyphenyl)-4-[(4-methoxyphenyl)sulfonylamino]benzamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(C(=O)Nc3cccc(OC)c3)cc2)cc1 |
| InChI | InChI=1S/C21H20N2O5S/c1-27-18-10-12-20(13-11-18)29(25,26)23-16-8-6-15(7-9-16)21(24)22-17-4-3-5-19(14-17)28-2/h3-14,23H,1-2H3,(H,22,24) |
| InChIKey | KFQLPORQQFQDON-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |