C21H26N4O5S — CID 56515635
N-(3-amino-3-oxopropyl)-2-[[4-(tert-butylsulfamoyl)benzoyl]amino]benzamide (PubChem CID 56515635) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-2-[[4-(tert-butylsulfamoyl)benzoyl]amino]benzamide.
| Compound Name | N-(3-amino-3-oxopropyl)-2-[[4-(tert-butylsulfamoyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 56515635 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-2-[[4-(tert-butylsulfamoyl)benzoyl]amino]benzamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)Nc2ccccc2C(=O)NCCC(N)=O)cc1 |
| InChI | InChI=1S/C21H26N4O5S/c1-21(2,3)25-31(29,30)15-10-8-14(9-11-15)19(27)24-17-7-5-4-6-16(17)20(28)23-13-12-18(22)26/h4-11,25H,12-13H2,1-3H3,(H2,22,26)(H,23,28)(H,24,27) |
| InChIKey | ITMFWUHKYQCCMT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |