C17H26N2O5S — CID 119219755
6-[[4-(tert-butylsulfamoyl)benzoyl]amino]hexanoic acid (PubChem CID 119219755) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is 6-[[4-(tert-butylsulfamoyl)benzoyl]amino]hexanoic acid.
| Compound Name | 6-[[4-(tert-butylsulfamoyl)benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119219755 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 6-[[4-(tert-butylsulfamoyl)benzoyl]amino]hexanoic acid |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)NCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C17H26N2O5S/c1-17(2,3)19-25(23,24)14-10-8-13(9-11-14)16(22)18-12-6-4-5-7-15(20)21/h8-11,19H,4-7,12H2,1-3H3,(H,18,22)(H,20,21) |
| InChIKey | LPVKTDUMZOPMPY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|