C23H31N3O7S — CID 170959681
7-[[4-[4-[(2-methylcycloprop-2-ene-1-carbonyl)amino]butanoylsulfamoyl]benzoyl]amino]heptanoic acid (PubChem CID 170959681) has the molecular formula C23H31N3O7S and a molecular weight of 493.58 g/mol. Its IUPAC name is 7-[[4-[4-[(2-methylcycloprop-2-ene-1-carbonyl)amino]butanoylsulfamoyl]benzoyl]amino]heptanoic acid.
| Compound Name | 7-[[4-[4-[(2-methylcycloprop-2-ene-1-carbonyl)amino]butanoylsulfamoyl]benzoyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 170959681 |
| Molecular Formula | C23H31N3O7S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 7-[[4-[4-[(2-methylcycloprop-2-ene-1-carbonyl)amino]butanoylsulfamoyl]benzoyl]amino]heptanoic acid |
| SMILES | CC1=CC1C(=O)NCCCC(=O)NS(=O)(=O)c1ccc(C(=O)NCCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C23H31N3O7S/c1-16-15-19(16)23(31)25-14-6-7-20(27)26-34(32,33)18-11-9-17(10-12-18)22(30)24-13-5-3-2-4-8-21(28)29/h9-12,15,19H,2-8,13-14H2,1H3,(H,24,30)(H,25,31)(H,26,27)(H,28,29) |
| InChIKey | BKGMGQUXBQLHCA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|