C28H38N2O8S — CID 174212613
tert-butyl 7-[[4-(pent-4-ynoylsulfamoyl)benzoyl]amino]heptanoate;pent-4-ynoic acid (PubChem CID 174212613) has the molecular formula C28H38N2O8S and a molecular weight of 562.69 g/mol. Its IUPAC name is tert-butyl 7-[[4-(pent-4-ynoylsulfamoyl)benzoyl]amino]heptanoate;pent-4-ynoic acid.
| Compound Name | tert-butyl 7-[[4-(pent-4-ynoylsulfamoyl)benzoyl]amino]heptanoate;pent-4-ynoic acid |
|---|---|
| PubChem CID | 174212613 |
| Molecular Formula | C28H38N2O8S |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | tert-butyl 7-[[4-(pent-4-ynoylsulfamoyl)benzoyl]amino]heptanoate;pent-4-ynoic acid |
| SMILES | C#CCCC(=O)NS(=O)(=O)c1ccc(C(=O)NCCCCCCC(=O)OC(C)(C)C)cc1.C#CCCC(=O)O |
| InChI | InChI=1S/C23H32N2O6S.C5H6O2/c1-5-6-11-20(26)25-32(29,30)19-15-13-18(14-16-19)22(28)24-17-10-8-7-9-12-21(27)31-23(2,3)4;1-2-3-4-5(6)7/h1,13-16H,6-12,17H2,2-4H3,(H,24,28)(H,25,26);1H,3-4H2,(H,6,7) |
| InChIKey | RUYKTSLTOSEYBK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 155.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|