C19H26N2O3 — CID 155928446
tert-butyl N-[5-[(4-ethynylbenzoyl)amino]pentyl]carbamate (PubChem CID 155928446) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl N-[5-[(4-ethynylbenzoyl)amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[(4-ethynylbenzoyl)amino]pentyl]carbamate |
|---|---|
| PubChem CID | 155928446 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | tert-butyl N-[5-[(4-ethynylbenzoyl)amino]pentyl]carbamate |
| SMILES | C#Cc1ccc(C(=O)NCCCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H26N2O3/c1-5-15-9-11-16(12-10-15)17(22)20-13-7-6-8-14-21-18(23)24-19(2,3)4/h1,9-12H,6-8,13-14H2,2-4H3,(H,20,22)(H,21,23) |
| InChIKey | ALGFBQZYTDBWRS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|