C15H22N2O4 — CID 118973665
tert-butyl N-[3-[(4-hydroxybenzoyl)amino]propyl]carbamate (PubChem CID 118973665) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is tert-butyl N-[3-[(4-hydroxybenzoyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(4-hydroxybenzoyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 118973665 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | tert-butyl N-[3-[(4-hydroxybenzoyl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H22N2O4/c1-15(2,3)21-14(20)17-10-4-9-16-13(19)11-5-7-12(18)8-6-11/h5-8,18H,4,9-10H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | UEUKHNNREKFRIO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|