C17H25N3O4 — CID 166946744
tert-butyl N-[4-[(4-formamidobenzoyl)amino]butyl]carbamate (PubChem CID 166946744) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl N-[4-[(4-formamidobenzoyl)amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(4-formamidobenzoyl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 166946744 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | tert-butyl N-[4-[(4-formamidobenzoyl)amino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNC(=O)c1ccc(NC=O)cc1 |
| InChI | InChI=1S/C17H25N3O4/c1-17(2,3)24-16(23)19-11-5-4-10-18-15(22)13-6-8-14(9-7-13)20-12-21/h6-9,12H,4-5,10-11H2,1-3H3,(H,18,22)(H,19,23)(H,20,21) |
| InChIKey | SJXDTDXPLATHEF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|