C24H33N3O5S — CID 170959729
tert-butyl 7-[[4-(pyridin-2-ylmethylsulfamoyl)benzoyl]amino]heptanoate (PubChem CID 170959729) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is tert-butyl 7-[[4-(pyridin-2-ylmethylsulfamoyl)benzoyl]amino]heptanoate.
| Compound Name | tert-butyl 7-[[4-(pyridin-2-ylmethylsulfamoyl)benzoyl]amino]heptanoate |
|---|---|
| PubChem CID | 170959729 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | tert-butyl 7-[[4-(pyridin-2-ylmethylsulfamoyl)benzoyl]amino]heptanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCNC(=O)c1ccc(S(=O)(=O)NCc2ccccn2)cc1 |
| InChI | InChI=1S/C24H33N3O5S/c1-24(2,3)32-22(28)11-6-4-5-8-17-26-23(29)19-12-14-21(15-13-19)33(30,31)27-18-20-10-7-9-16-25-20/h7,9-10,12-16,27H,4-6,8,11,17-18H2,1-3H3,(H,26,29) |
| InChIKey | LXPDNMACRHPKME-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|