C15H14F3N3O3S — CID 40665030
4-(pyridin-2-ylmethylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 40665030) has the molecular formula C15H14F3N3O3S and a molecular weight of 373.36 g/mol. Its IUPAC name is 4-(pyridin-2-ylmethylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-(pyridin-2-ylmethylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 40665030 |
| Molecular Formula | C15H14F3N3O3S |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 4-(pyridin-2-ylmethylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(S(=O)(=O)NCc2ccccn2)cc1 |
| InChI | InChI=1S/C15H14F3N3O3S/c16-15(17,18)10-20-14(22)11-4-6-13(7-5-11)25(23,24)21-9-12-3-1-2-8-19-12/h1-8,21H,9-10H2,(H,20,22) |
| InChIKey | UBGAPLVFUKKENO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |