C19H16F3N3O3S — CID 47083607
4-(quinolin-8-ylmethylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 47083607) has the molecular formula C19H16F3N3O3S and a molecular weight of 423.42 g/mol. Its IUPAC name is 4-(quinolin-8-ylmethylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-(quinolin-8-ylmethylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 47083607 |
| Molecular Formula | C19H16F3N3O3S |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 4-(quinolin-8-ylmethylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(S(=O)(=O)NCc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C19H16F3N3O3S/c20-19(21,22)12-24-18(26)14-6-8-16(9-7-14)29(27,28)25-11-15-4-1-3-13-5-2-10-23-17(13)15/h1-10,25H,11-12H2,(H,24,26) |
| InChIKey | FXHBZTPJFHRJFK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |