C9H10F3N3O — CID 47134204
1-(pyridin-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 47134204) has the molecular formula C9H10F3N3O and a molecular weight of 233.19 g/mol. Its IUPAC name is 1-(pyridin-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(pyridin-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 47134204 |
| Molecular Formula | C9H10F3N3O |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 1-(pyridin-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCc1ccccn1)NCC(F)(F)F |
| InChI | InChI=1S/C9H10F3N3O/c10-9(11,12)6-15-8(16)14-5-7-3-1-2-4-13-7/h1-4H,5-6H2,(H2,14,15,16) |
| InChIKey | DOAMBIPAJLAHKX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |