C19H22N4O5S — CID 56515891
N-(3-amino-3-oxopropyl)-2-[[4-(ethylsulfamoyl)benzoyl]amino]benzamide (PubChem CID 56515891) has the molecular formula C19H22N4O5S and a molecular weight of 418.48 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-2-[[4-(ethylsulfamoyl)benzoyl]amino]benzamide.
| Compound Name | N-(3-amino-3-oxopropyl)-2-[[4-(ethylsulfamoyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 56515891 |
| Molecular Formula | C19H22N4O5S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-2-[[4-(ethylsulfamoyl)benzoyl]amino]benzamide |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)Nc2ccccc2C(=O)NCCC(N)=O)cc1 |
| InChI | InChI=1S/C19H22N4O5S/c1-2-22-29(27,28)14-9-7-13(8-10-14)18(25)23-16-6-4-3-5-15(16)19(26)21-12-11-17(20)24/h3-10,22H,2,11-12H2,1H3,(H2,20,24)(H,21,26)(H,23,25) |
| InChIKey | JSUZLHGGYCHUFU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |