C18H23Cl2N3O3 — CID 119619117
N-(6-amino-1,3-benzodioxol-5-yl)-4-[methyl(propyl)amino]benzamide;dihydrochloride (PubChem CID 119619117) has the molecular formula C18H23Cl2N3O3 and a molecular weight of 400.31 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-4-[methyl(propyl)amino]benzamide;dihydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-[methyl(propyl)amino]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119619117 |
| Molecular Formula | C18H23Cl2N3O3 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-[methyl(propyl)amino]benzamide;dihydrochloride |
| SMILES | CCCN(C)c1ccc(C(=O)Nc2cc3c(cc2N)OCO3)cc1.Cl.Cl |
| InChI | InChI=1S/C18H21N3O3.2ClH/c1-3-8-21(2)13-6-4-12(5-7-13)18(22)20-15-10-17-16(9-14(15)19)23-11-24-17;;/h4-7,9-10H,3,8,11,19H2,1-2H3,(H,20,22);2*1H |
| InChIKey | LDDMOPTUZZDYEN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|