C21H27Cl2N3O4 — CID 119618458
N-(6-amino-1,3-benzodioxol-5-yl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide;dihydrochloride (PubChem CID 119618458) has the molecular formula C21H27Cl2N3O4 and a molecular weight of 456.37 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide;dihydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119618458 |
| Molecular Formula | C21H27Cl2N3O4 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide;dihydrochloride |
| SMILES | CC1CN(Cc2ccc(C(=O)Nc3cc4c(cc3N)OCO4)cc2)CC(C)O1.Cl.Cl |
| InChI | InChI=1S/C21H25N3O4.2ClH/c1-13-9-24(10-14(2)28-13)11-15-3-5-16(6-4-15)21(25)23-18-8-20-19(7-17(18)22)26-12-27-20;;/h3-8,13-14H,9-12,22H2,1-2H3,(H,23,25);2*1H |
| InChIKey | JMIYZBMYHAXNNR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|