C20H22Br2N2O2 — CID 55625307
N-(2,5-dibromophenyl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide (PubChem CID 55625307) has the molecular formula C20H22Br2N2O2 and a molecular weight of 482.22 g/mol. Its IUPAC name is N-(2,5-dibromophenyl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide.
| Compound Name | N-(2,5-dibromophenyl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55625307 |
| Molecular Formula | C20H22Br2N2O2 |
| Molecular Weight | 482.22 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | N-(2,5-dibromophenyl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide |
| SMILES | CC1CN(Cc2ccc(C(=O)Nc3cc(Br)ccc3Br)cc2)CC(C)O1 |
| InChI | InChI=1S/C20H22Br2N2O2/c1-13-10-24(11-14(2)26-13)12-15-3-5-16(6-4-15)20(25)23-19-9-17(21)7-8-18(19)22/h3-9,13-14H,10-12H2,1-2H3,(H,23,25) |
| InChIKey | HAPGRBRCKHZQJX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.22 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |