C21H30N2O2 — CID 47027087
N-(dicyclopropylmethyl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide (PubChem CID 47027087) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide.
| Compound Name | N-(dicyclopropylmethyl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 47027087 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | N-(dicyclopropylmethyl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide |
| SMILES | CC1CN(Cc2ccc(C(=O)NC(C3CC3)C3CC3)cc2)CC(C)O1 |
| InChI | InChI=1S/C21H30N2O2/c1-14-11-23(12-15(2)25-14)13-16-3-5-19(6-4-16)21(24)22-20(17-7-8-17)18-9-10-18/h3-6,14-15,17-18,20H,7-13H2,1-2H3,(H,22,24) |
| InChIKey | LLVAVKZDBOZQLL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |