C20H23BrN2O2 — CID 55623885
N-(3-bromophenyl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide (PubChem CID 55623885) has the molecular formula C20H23BrN2O2 and a molecular weight of 403.32 g/mol. Its IUPAC name is N-(3-bromophenyl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide.
| Compound Name | N-(3-bromophenyl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55623885 |
| Molecular Formula | C20H23BrN2O2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-(3-bromophenyl)-4-[(2,6-dimethylmorpholin-4-yl)methyl]benzamide |
| SMILES | CC1CN(Cc2ccc(C(=O)Nc3cccc(Br)c3)cc2)CC(C)O1 |
| InChI | InChI=1S/C20H23BrN2O2/c1-14-11-23(12-15(2)25-14)13-16-6-8-17(9-7-16)20(24)22-19-5-3-4-18(21)10-19/h3-10,14-15H,11-13H2,1-2H3,(H,22,24) |
| InChIKey | AUVUQWRFLSITPH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |