C27H38N4O2 — CID 46404460
4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]benzamide (PubChem CID 46404460) has the molecular formula C27H38N4O2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]benzamide.
| Compound Name | 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 46404460 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]benzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ccc(CN4CC(C)OC(C)C4)cc3)c(C)c2)CC1 |
| InChI | InChI=1S/C27H38N4O2/c1-5-29-12-14-31(15-13-29)25-10-11-26(20(2)16-25)28-27(32)24-8-6-23(7-9-24)19-30-17-21(3)33-22(4)18-30/h6-11,16,21-22H,5,12-15,17-19H2,1-4H3,(H,28,32) |
| InChIKey | ATLQXUBHOOHRLV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|