C21H24F3N3O — CID 34194003
N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-4-(trifluoromethyl)benzamide (PubChem CID 34194003) has the molecular formula C21H24F3N3O and a molecular weight of 391.44 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 34194003 |
| Molecular Formula | C21H24F3N3O |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ccc(C(F)(F)F)cc3)c(C)c2)CC1 |
| InChI | InChI=1S/C21H24F3N3O/c1-3-26-10-12-27(13-11-26)18-8-9-19(15(2)14-18)25-20(28)16-4-6-17(7-5-16)21(22,23)24/h4-9,14H,3,10-13H2,1-2H3,(H,25,28) |
| InChIKey | YOVLTUGXWVEZRP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|