C24H30N4O2 — CID 55560107
4-[(E)-3-[4-(4-ethylpiperazin-1-yl)-2-methylanilino]-3-oxoprop-1-enyl]-N-methylbenzamide (PubChem CID 55560107) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-[(E)-3-[4-(4-ethylpiperazin-1-yl)-2-methylanilino]-3-oxoprop-1-enyl]-N-methylbenzamide.
| Compound Name | 4-[(E)-3-[4-(4-ethylpiperazin-1-yl)-2-methylanilino]-3-oxoprop-1-enyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 55560107 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 4-[(E)-3-[4-(4-ethylpiperazin-1-yl)-2-methylanilino]-3-oxoprop-1-enyl]-N-methylbenzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)/C=C/c3ccc(C(=O)NC)cc3)c(C)c2)CC1 |
| InChI | InChI=1S/C24H30N4O2/c1-4-27-13-15-28(16-14-27)21-10-11-22(18(2)17-21)26-23(29)12-7-19-5-8-20(9-6-19)24(30)25-3/h5-12,17H,4,13-16H2,1-3H3,(H,25,30)(H,26,29)/b12-7+ |
| InChIKey | QRWICRJIOIGAAH-KPKJPENVSA-N |
| XLogP | 3.15 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|