C22H25F2N3O2 — CID 18082463
(E)-3-[4-(difluoromethoxy)phenyl]-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 18082463) has the molecular formula C22H25F2N3O2 and a molecular weight of 401.46 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 18082463 |
| Molecular Formula | C22H25F2N3O2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)/C=C/c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H25F2N3O2/c1-16-15-18(27-13-11-26(2)12-14-27)6-9-20(16)25-21(28)10-5-17-3-7-19(8-4-17)29-22(23)24/h3-10,15,22H,11-14H2,1-2H3,(H,25,28)/b10-5+ |
| InChIKey | OMIRXMZPRNAGFH-BJMVGYQFSA-N |
| XLogP | 4.00 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|