C18H17F2NO2 — CID 8502468
(E)-3-[4-(difluoromethoxy)phenyl]-N-(2,6-dimethylphenyl)prop-2-enamide (PubChem CID 8502468) has the molecular formula C18H17F2NO2 and a molecular weight of 317.34 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-N-(2,6-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-(2,6-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8502468 |
| Molecular Formula | C18H17F2NO2 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-(2,6-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(C)c1NC(=O)/C=C/c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H17F2NO2/c1-12-4-3-5-13(2)17(12)21-16(22)11-8-14-6-9-15(10-7-14)23-18(19)20/h3-11,18H,1-2H3,(H,21,22)/b11-8+ |
| InChIKey | RAPHREPARQDPJW-DHZHZOJOSA-N |
| XLogP | 4.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|