C23H23F2N3O2 — CID 19338014
(Z)-3-[4-(difluoromethoxy)phenyl]-N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enamide (PubChem CID 19338014) has the molecular formula C23H23F2N3O2 and a molecular weight of 411.45 g/mol. Its IUPAC name is (Z)-3-[4-(difluoromethoxy)phenyl]-N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enamide.
| Compound Name | (Z)-3-[4-(difluoromethoxy)phenyl]-N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 19338014 |
| Molecular Formula | C23H23F2N3O2 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (Z)-3-[4-(difluoromethoxy)phenyl]-N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enamide |
| SMILES | Cc1ccc(Cn2nc(C)c(NC(=O)/C=C\c3ccc(OC(F)F)cc3)c2C)cc1 |
| InChI | InChI=1S/C23H23F2N3O2/c1-15-4-6-19(7-5-15)14-28-17(3)22(16(2)27-28)26-21(29)13-10-18-8-11-20(12-9-18)30-23(24)25/h4-13,23H,14H2,1-3H3,(H,26,29)/b13-10- |
| InChIKey | YTXYGGDYBRQJIO-RAXLEYEMSA-N |
| XLogP | 5.11 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|