C16H17F2N3O2 — CID 19394362
(Z)-3-[4-(difluoromethoxy)phenyl]-N-(1-ethyl-5-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 19394362) has the molecular formula C16H17F2N3O2 and a molecular weight of 321.33 g/mol. Its IUPAC name is (Z)-3-[4-(difluoromethoxy)phenyl]-N-(1-ethyl-5-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(difluoromethoxy)phenyl]-N-(1-ethyl-5-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 19394362 |
| Molecular Formula | C16H17F2N3O2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (Z)-3-[4-(difluoromethoxy)phenyl]-N-(1-ethyl-5-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCn1ncc(NC(=O)/C=C\c2ccc(OC(F)F)cc2)c1C |
| InChI | InChI=1S/C16H17F2N3O2/c1-3-21-11(2)14(10-19-21)20-15(22)9-6-12-4-7-13(8-5-12)23-16(17)18/h4-10,16H,3H2,1-2H3,(H,20,22)/b9-6- |
| InChIKey | CYCLWMVOTLAPMV-TWGQIWQCSA-N |
| XLogP | 3.46 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|