C17H19F2N3O2 — CID 19581807
(Z)-3-[4-(difluoromethoxy)phenyl]-N-[3-(4-methylpyrazol-1-yl)propyl]prop-2-enamide (PubChem CID 19581807) has the molecular formula C17H19F2N3O2 and a molecular weight of 335.35 g/mol. Its IUPAC name is (Z)-3-[4-(difluoromethoxy)phenyl]-N-[3-(4-methylpyrazol-1-yl)propyl]prop-2-enamide.
| Compound Name | (Z)-3-[4-(difluoromethoxy)phenyl]-N-[3-(4-methylpyrazol-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 19581807 |
| Molecular Formula | C17H19F2N3O2 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (Z)-3-[4-(difluoromethoxy)phenyl]-N-[3-(4-methylpyrazol-1-yl)propyl]prop-2-enamide |
| SMILES | Cc1cnn(CCCNC(=O)/C=C\c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C17H19F2N3O2/c1-13-11-21-22(12-13)10-2-9-20-16(23)8-5-14-3-6-15(7-4-14)24-17(18)19/h3-8,11-12,17H,2,9-10H2,1H3,(H,20,23)/b8-5- |
| InChIKey | XSWGNWSSSOONGT-YVMONPNESA-N |
| XLogP | 3.01 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|