C16H16F2N4O4 — CID 19283189
(Z)-3-[4-(difluoromethoxy)phenyl]-N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]prop-2-enamide (PubChem CID 19283189) has the molecular formula C16H16F2N4O4 and a molecular weight of 366.32 g/mol. Its IUPAC name is (Z)-3-[4-(difluoromethoxy)phenyl]-N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-[4-(difluoromethoxy)phenyl]-N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 19283189 |
| Molecular Formula | C16H16F2N4O4 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (Z)-3-[4-(difluoromethoxy)phenyl]-N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]prop-2-enamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1CCNC(=O)/C=C\c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H16F2N4O4/c1-11-10-14(22(24)25)20-21(11)9-8-19-15(23)7-4-12-2-5-13(6-3-12)26-16(17)18/h2-7,10,16H,8-9H2,1H3,(H,19,23)/b7-4- |
| InChIKey | OIBVUHDGKGYILZ-DAXSKMNVSA-N |
| XLogP | 2.53 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|