C14H19N7O5 — CID 19283212
2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)-N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]propanamide (PubChem CID 19283212) has the molecular formula C14H19N7O5 and a molecular weight of 365.35 g/mol. Its IUPAC name is 2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)-N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]propanamide.
| Compound Name | 2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)-N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 19283212 |
| Molecular Formula | C14H19N7O5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)-N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]propanamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1CCNC(=O)C(C)Cn1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C14H19N7O5/c1-9(8-19-11(3)7-13(17-19)21(25)26)14(22)15-4-5-18-10(2)6-12(16-18)20(23)24/h6-7,9H,4-5,8H2,1-3H3,(H,15,22) |
| InChIKey | XPUYWKSBDRTLHV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 151.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|