C18H23F3N6O3 — CID 19568324
N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propanamide (PubChem CID 19568324) has the molecular formula C18H23F3N6O3 and a molecular weight of 428.42 g/mol. Its IUPAC name is N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19568324 |
| Molecular Formula | C18H23F3N6O3 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1CC(C)C(=O)NCCCn1nc(C(F)(F)F)cc1C1CC1 |
| InChI | InChI=1S/C18H23F3N6O3/c1-11(10-26-12(2)8-16(24-26)27(29)30)17(28)22-6-3-7-25-14(13-4-5-13)9-15(23-25)18(19,20)21/h8-9,11,13H,3-7,10H2,1-2H3,(H,22,28) |
| InChIKey | XCFMQCOMVHNLSH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|