C16H19F3N6O3 — CID 19555573
N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-nitropyrazol-1-yl)propanamide (PubChem CID 19555573) has the molecular formula C16H19F3N6O3 and a molecular weight of 400.36 g/mol. Its IUPAC name is N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19555573 |
| Molecular Formula | C16H19F3N6O3 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-nitropyrazol-1-yl)propanamide |
| SMILES | O=C(CCn1cc([N+](=O)[O-])cn1)NCCCn1nc(C(F)(F)F)cc1C1CC1 |
| InChI | InChI=1S/C16H19F3N6O3/c17-16(18,19)14-8-13(11-2-3-11)24(22-14)6-1-5-20-15(26)4-7-23-10-12(9-21-23)25(27)28/h8-11H,1-7H2,(H,20,26) |
| InChIKey | WBMQZVBEVWKADT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|