C15H17F3N6O4 — CID 19511054
N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19511054) has the molecular formula C15H17F3N6O4 and a molecular weight of 402.33 g/mol. Its IUPAC name is N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19511054 |
| Molecular Formula | C15H17F3N6O4 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | COc1n[nH]c(C(=O)NCCCn2nc(C(F)(F)F)cc2C2CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17F3N6O4/c1-28-14-12(24(26)27)11(20-21-14)13(25)19-5-2-6-23-9(8-3-4-8)7-10(22-23)15(16,17)18/h7-8H,2-6H2,1H3,(H,19,25)(H,20,21) |
| InChIKey | WTJCRWRRAPDIIX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|