C13H17ClN6O4 — CID 19511046
N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19511046) has the molecular formula C13H17ClN6O4 and a molecular weight of 356.77 g/mol. Its IUPAC name is N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19511046 |
| Molecular Formula | C13H17ClN6O4 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | COc1n[nH]c(C(=O)NCCCn2nc(C)c(Cl)c2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17ClN6O4/c1-7-9(14)8(2)19(18-7)6-4-5-15-12(21)10-11(20(22)23)13(24-3)17-16-10/h4-6H2,1-3H3,(H,15,21)(H,16,17) |
| InChIKey | FMGXBLRCRKTSKL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|