C15H16Cl2N4O3 — CID 19295602
4-chloro-N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-nitrobenzamide (PubChem CID 19295602) has the molecular formula C15H16Cl2N4O3 and a molecular weight of 371.22 g/mol. Its IUPAC name is 4-chloro-N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 19295602 |
| Molecular Formula | C15H16Cl2N4O3 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 4-chloro-N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-nitrobenzamide |
| SMILES | Cc1nn(CCCNC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c(C)c1Cl |
| InChI | InChI=1S/C15H16Cl2N4O3/c1-9-14(17)10(2)20(19-9)7-3-6-18-15(22)11-4-5-12(16)13(8-11)21(23)24/h4-5,8H,3,6-7H2,1-2H3,(H,18,22) |
| InChIKey | APFHUJICRYTWQH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|