C21H19Cl3N4O4 — CID 19332121
4-[(2-chloro-4-nitrophenoxy)methyl]-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]benzamide (PubChem CID 19332121) has the molecular formula C21H19Cl3N4O4 and a molecular weight of 497.77 g/mol. Its IUPAC name is 4-[(2-chloro-4-nitrophenoxy)methyl]-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]benzamide.
| Compound Name | 4-[(2-chloro-4-nitrophenoxy)methyl]-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 19332121 |
| Molecular Formula | C21H19Cl3N4O4 |
| Molecular Weight | 497.77 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 4-[(2-chloro-4-nitrophenoxy)methyl]-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]benzamide |
| SMILES | Cc1nn(CCCNC(=O)c2ccc(COc3ccc([N+](=O)[O-])cc3Cl)cc2)c(Cl)c1Cl |
| InChI | InChI=1S/C21H19Cl3N4O4/c1-13-19(23)20(24)27(26-13)10-2-9-25-21(29)15-5-3-14(4-6-15)12-32-18-8-7-16(28(30)31)11-17(18)22/h3-8,11H,2,9-10,12H2,1H3,(H,25,29) |
| InChIKey | BTPVIUGRSLOPOR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.77 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|