C28H25ClN4O6 — CID 19406765
methyl 2-[[4-[[4-[(2-chloro-4-nitrophenoxy)methyl]benzoyl]amino]-3,5-dimethylpyrazol-1-yl]methyl]benzoate (PubChem CID 19406765) has the molecular formula C28H25ClN4O6 and a molecular weight of 548.98 g/mol. Its IUPAC name is methyl 2-[[4-[[4-[(2-chloro-4-nitrophenoxy)methyl]benzoyl]amino]-3,5-dimethylpyrazol-1-yl]methyl]benzoate.
| Compound Name | methyl 2-[[4-[[4-[(2-chloro-4-nitrophenoxy)methyl]benzoyl]amino]-3,5-dimethylpyrazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 19406765 |
| Molecular Formula | C28H25ClN4O6 |
| Molecular Weight | 548.98 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | methyl 2-[[4-[[4-[(2-chloro-4-nitrophenoxy)methyl]benzoyl]amino]-3,5-dimethylpyrazol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1Cn1nc(C)c(NC(=O)c2ccc(COc3ccc([N+](=O)[O-])cc3Cl)cc2)c1C |
| InChI | InChI=1S/C28H25ClN4O6/c1-17-26(18(2)32(31-17)15-21-6-4-5-7-23(21)28(35)38-3)30-27(34)20-10-8-19(9-11-20)16-39-25-13-12-22(33(36)37)14-24(25)29/h4-14H,15-16H2,1-3H3,(H,30,34) |
| InChIKey | FCCPGMVSBDBYKM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.98 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|