C26H21ClN4O6 — CID 19402365
methyl 2-[[4-[[4-[(2-chloro-4-nitrophenoxy)methyl]benzoyl]amino]pyrazol-1-yl]methyl]benzoate (PubChem CID 19402365) has the molecular formula C26H21ClN4O6 and a molecular weight of 520.93 g/mol. Its IUPAC name is methyl 2-[[4-[[4-[(2-chloro-4-nitrophenoxy)methyl]benzoyl]amino]pyrazol-1-yl]methyl]benzoate.
| Compound Name | methyl 2-[[4-[[4-[(2-chloro-4-nitrophenoxy)methyl]benzoyl]amino]pyrazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 19402365 |
| Molecular Formula | C26H21ClN4O6 |
| Molecular Weight | 520.93 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | methyl 2-[[4-[[4-[(2-chloro-4-nitrophenoxy)methyl]benzoyl]amino]pyrazol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1Cn1cc(NC(=O)c2ccc(COc3ccc([N+](=O)[O-])cc3Cl)cc2)cn1 |
| InChI | InChI=1S/C26H21ClN4O6/c1-36-26(33)22-5-3-2-4-19(22)14-30-15-20(13-28-30)29-25(32)18-8-6-17(7-9-18)16-37-24-11-10-21(31(34)35)12-23(24)27/h2-13,15H,14,16H2,1H3,(H,29,32) |
| InChIKey | GHOQZEDCCTYZAI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.93 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|