C14H14Cl3N3O — CID 19332207
4-chloro-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]benzamide (PubChem CID 19332207) has the molecular formula C14H14Cl3N3O and a molecular weight of 346.65 g/mol. Its IUPAC name is 4-chloro-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]benzamide.
| Compound Name | 4-chloro-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 19332207 |
| Molecular Formula | C14H14Cl3N3O |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 4-chloro-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]benzamide |
| SMILES | Cc1nn(CCCNC(=O)c2ccc(Cl)cc2)c(Cl)c1Cl |
| InChI | InChI=1S/C14H14Cl3N3O/c1-9-12(16)13(17)20(19-9)8-2-7-18-14(21)10-3-5-11(15)6-4-10/h3-6H,2,7-8H2,1H3,(H,18,21) |
| InChIKey | VAIPGIMHZNEHIJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|