C18H18Cl3N5O2 — CID 19280407
1-[(4-chlorophenoxy)methyl]-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]pyrazole-3-carboxamide (PubChem CID 19280407) has the molecular formula C18H18Cl3N5O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is 1-[(4-chlorophenoxy)methyl]-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-chlorophenoxy)methyl]-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19280407 |
| Molecular Formula | C18H18Cl3N5O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 1-[(4-chlorophenoxy)methyl]-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]pyrazole-3-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)c2ccn(COc3ccc(Cl)cc3)n2)c(Cl)c1Cl |
| InChI | InChI=1S/C18H18Cl3N5O2/c1-12-16(20)17(21)26(23-12)9-2-8-22-18(27)15-7-10-25(24-15)11-28-14-5-3-13(19)4-6-14/h3-7,10H,2,8-9,11H2,1H3,(H,22,27) |
| InChIKey | SMKRIHIULYAFLN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|