C19H21Cl2N5O — CID 19477748
N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 19477748) has the molecular formula C19H21Cl2N5O and a molecular weight of 406.32 g/mol. Its IUPAC name is N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19477748 |
| Molecular Formula | C19H21Cl2N5O |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)c2c(C)nn(-c3ccccc3)c2C)c(Cl)c1Cl |
| InChI | InChI=1S/C19H21Cl2N5O/c1-12-16(14(3)26(24-12)15-8-5-4-6-9-15)19(27)22-10-7-11-25-18(21)17(20)13(2)23-25/h4-6,8-9H,7,10-11H2,1-3H3,(H,22,27) |
| InChIKey | BBWYZYNLSYRNIZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|