C20H24BrN5O — CID 19477685
N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 19477685) has the molecular formula C20H24BrN5O and a molecular weight of 430.35 g/mol. Its IUPAC name is N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19477685 |
| Molecular Formula | C20H24BrN5O |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)c2c(C)nn(-c3ccccc3)c2C)c(C)c1Br |
| InChI | InChI=1S/C20H24BrN5O/c1-13-18(15(3)26(24-13)17-9-6-5-7-10-17)20(27)22-11-8-12-25-16(4)19(21)14(2)23-25/h5-7,9-10H,8,11-12H2,1-4H3,(H,22,27) |
| InChIKey | GYDRHWFTEFXPOT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|