C18H25N3O3 — CID 134029697
N-[3-(2-methoxyethoxy)propyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 134029697) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)propyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[3-(2-methoxyethoxy)propyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134029697 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-[3-(2-methoxyethoxy)propyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | COCCOCCCNC(=O)c1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C18H25N3O3/c1-14-17(18(22)19-10-7-11-24-13-12-23-3)15(2)21(20-14)16-8-5-4-6-9-16/h4-6,8-9H,7,10-13H2,1-3H3,(H,19,22) |
| InChIKey | DRORMAQHQZLUAO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|